C19H35NO5 — CID 70833310
(6R,7R,7aR)-6,7-dibutoxy-5-(butoxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 70833310) has the molecular formula C19H35NO5 and a molecular weight of 357.49 g/mol. Its IUPAC name is (6R,7R,7aR)-6,7-dibutoxy-5-(butoxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (6R,7R,7aR)-6,7-dibutoxy-5-(butoxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 70833310 |
| Molecular Formula | C19H35NO5 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | (6R,7R,7aR)-6,7-dibutoxy-5-(butoxymethyl)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | CCCCOCC1[C@@H](OCCCC)[C@H](OCCCC)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C19H35NO5/c1-4-7-10-22-13-15-17(23-11-8-5-2)18(24-12-9-6-3)16-14-25-19(21)20(15)16/h15-18H,4-14H2,1-3H3/t15?,16-,17-,18-/m1/s1 |
| InChIKey | ZNMYSLQVYJKKHC-QSLYMNIHSA-N |
| XLogP | 3.38 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|