About 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole
1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole (PubChem CID 70833318) has the molecular formula C14H12F3N3
and a molecular weight of 279.26 g/mol. Its IUPAC name is 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole |
| PubChem CID | 70833318 |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole |
| SMILES | CN1C(c2ccncc2)=NC2C=CC(C(F)(F)F)=CC21 |
| InChI | InChI=1S/C14H12F3N3/c1-20-12-8-10(14(15,16)17)2-3-11(12)19-13(20)9-4-6-18-7-5-9/h2-8,11-12H,1H3 |
| InChIKey | YWJICAUOCSOYEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole?
The IUPAC name of 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole (CID 70833318) is 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole.
What is the SMILES notation for 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole?
The canonical SMILES for 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole is CN1C(c2ccncc2)=NC2C=CC(C(F)(F)F)=CC21.
What is the InChIKey of 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole?
The InChIKey is YWJICAUOCSOYEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N3/c1-20-12-8-10(14(15,16)17)2-3-11(12)19-13(20)9-4-6-18-7-5-9/h2-8,11-12H,1H3.
What are the key properties of 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole?
1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole has a molecular weight of 279.26 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-pyridin-4-yl-6-(trifluoromethyl)-3a,7a-dihydrobenzimidazole is sourced from PubChem (CID 70833318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).