C17H20ClNO4 — CID 70834612
(1R)-1-[(2-chloro-4,5-dihydroxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one (PubChem CID 70834612) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is (1R)-1-[(2-chloro-4,5-dihydroxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one.
| Compound Name | (1R)-1-[(2-chloro-4,5-dihydroxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 70834612 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (1R)-1-[(2-chloro-4,5-dihydroxyphenyl)methyl]-2-(hydroxymethyl)-1,3,4,5,7,8-hexahydroisoquinolin-6-one |
| SMILES | O=C1CCC2=C(CCN(CO)[C@@H]2Cc2cc(O)c(O)cc2Cl)C1 |
| InChI | InChI=1S/C17H20ClNO4/c18-14-8-17(23)16(22)7-11(14)6-15-13-2-1-12(21)5-10(13)3-4-19(15)9-20/h7-8,15,20,22-23H,1-6,9H2/t15-/m1/s1 |
| InChIKey | PNYGLIWNFZRMSC-OAHLLOKOSA-N |
| XLogP | 2.37 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|