C14H12O5 — CID 70834854
(1S,5S)-11-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-3,7-dione (PubChem CID 70834854) has the molecular formula C14H12O5 and a molecular weight of 260.24 g/mol. Its IUPAC name is (1S,5S)-11-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-3,7-dione.
| Compound Name | (1S,5S)-11-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-3,7-dione |
|---|---|
| PubChem CID | 70834854 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (1S,5S)-11-methoxy-6,15-dioxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-triene-3,7-dione |
| SMILES | COc1ccc2c3c1O[C@H]1CC(=O)C[C@H](OC2=O)C31 |
| InChI | InChI=1S/C14H12O5/c1-17-8-3-2-7-11-12-9(18-13(8)11)4-6(15)5-10(12)19-14(7)16/h2-3,9-10,12H,4-5H2,1H3/t9-,10-,12?/m0/s1 |
| InChIKey | VQIIYQYQKJZOMU-HVFQMFNGSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |