About 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine
4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 70835820) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine |
| PubChem CID | 70835820 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | COc1nc(N(C)C)nc2c1cnn2C(C)C |
| InChI | InChI=1S/C11H17N5O/c1-7(2)16-9-8(6-12-16)10(17-5)14-11(13-9)15(3)4/h6-7H,1-5H3 |
| InChIKey | LLWOGHNSZCMTAX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine?
The IUPAC name of 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine (CID 70835820) is 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine is COc1nc(N(C)C)nc2c1cnn2C(C)C.
What is the InChIKey of 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine?
The InChIKey is LLWOGHNSZCMTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-7(2)16-9-8(6-12-16)10(17-5)14-11(13-9)15(3)4/h6-7H,1-5H3.
What are the key properties of 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine?
4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine has a molecular weight of 235.29 g/mol, XLogP of 1.48, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N-dimethyl-1-propan-2-ylpyrazolo[5,4-d]pyrimidin-6-amine is sourced from PubChem (CID 70835820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).