C26H41FN4O7S — CID 70835886
tert-butyl N-[(1S,4R,6S,7Z)-4-(fluoromethylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate (PubChem CID 70835886) has the molecular formula C26H41FN4O7S and a molecular weight of 572.70 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R,6S,7Z)-4-(fluoromethylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R,6S,7Z)-4-(fluoromethylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
|---|---|
| PubChem CID | 70835886 |
| Molecular Formula | C26H41FN4O7S |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | tert-butyl N-[(1S,4R,6S,7Z)-4-(fluoromethylsulfonylcarbamoyl)-2,17-dioxo-3,18-diazatricyclo[16.3.0.04,6]henicos-7-en-16-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)CF)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C26H41FN4O7S/c1-25(2,3)38-24(35)28-19-13-10-8-6-4-5-7-9-12-18-16-26(18,23(34)30-39(36,37)17-27)29-21(32)20-14-11-15-31(20)22(19)33/h9,12,18-20H,4-8,10-11,13-17H2,1-3H3,(H,28,35)(H,29,32)(H,30,34)/b12-9-/t18-,19?,20+,26-/m1/s1 |
| InChIKey | WWCBANVQUKZIPH-GUDDGQSHSA-N |
| XLogP | 2.42 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|