C20H20F3N5OS — CID 70836098
2-[[2-[4-methyl-3-(methylamino)anilino]pyrimidin-4-yl]amino]-6-(2,2,2-trifluoroethoxy)benzenethiol (PubChem CID 70836098) has the molecular formula C20H20F3N5OS and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[[2-[4-methyl-3-(methylamino)anilino]pyrimidin-4-yl]amino]-6-(2,2,2-trifluoroethoxy)benzenethiol.
| Compound Name | 2-[[2-[4-methyl-3-(methylamino)anilino]pyrimidin-4-yl]amino]-6-(2,2,2-trifluoroethoxy)benzenethiol |
|---|---|
| PubChem CID | 70836098 |
| Molecular Formula | C20H20F3N5OS |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[[2-[4-methyl-3-(methylamino)anilino]pyrimidin-4-yl]amino]-6-(2,2,2-trifluoroethoxy)benzenethiol |
| SMILES | CNc1cc(Nc2nccc(Nc3cccc(OCC(F)(F)F)c3S)n2)ccc1C |
| InChI | InChI=1S/C20H20F3N5OS/c1-12-6-7-13(10-15(12)24-2)26-19-25-9-8-17(28-19)27-14-4-3-5-16(18(14)30)29-11-20(21,22)23/h3-10,24,30H,11H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | LSEMGODKYMVWIF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|