About 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid
3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid (PubChem CID 70836470) has the molecular formula C20H30O3
and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid |
| PubChem CID | 70836470 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid |
| SMILES | O=C(O)CCC1C=CC(OC2CCCC3(CCCCC3)C2)=CC1 |
| InChI | InChI=1S/C20H30O3/c21-19(22)11-8-16-6-9-17(10-7-16)23-18-5-4-14-20(15-18)12-2-1-3-13-20/h6,9-10,16,18H,1-5,7-8,11-15H2,(H,21,22) |
| InChIKey | PFDUFKGECWFKFL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid?
The IUPAC name of 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid (CID 70836470) is 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid.
What is the SMILES notation for 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid?
The canonical SMILES for 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid is O=C(O)CCC1C=CC(OC2CCCC3(CCCCC3)C2)=CC1.
What is the InChIKey of 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid?
The InChIKey is PFDUFKGECWFKFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O3/c21-19(22)11-8-16-6-9-17(10-7-16)23-18-5-4-14-20(15-18)12-2-1-3-13-20/h6,9-10,16,18H,1-5,7-8,11-15H2,(H,21,22).
What are the key properties of 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid?
3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid has a molecular weight of 318.46 g/mol, XLogP of 5.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-spiro[5.5]undecan-4-yloxycyclohexa-2,4-dien-1-yl)propanoic acid is sourced from PubChem (CID 70836470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).