About 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine
4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine (PubChem CID 7083657) has the molecular formula C14H19N6O4+
and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine |
| PubChem CID | 7083657 |
| Molecular Formula | C14H19N6O4+ |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine |
| SMILES | Nc1nonc1OCC[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H18N6O4/c15-13-14(17-24-16-13)23-10-9-18-5-7-19(8-6-18)11-1-3-12(4-2-11)20(21)22/h1-4H,5-10H2,(H2,15,16)/p+1 |
| InChIKey | QQIONKJGSZDMJO-UHFFFAOYSA-O |
| XLogP | -0.66 |
| TPSA | 124.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine?
The IUPAC name of 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine (CID 7083657) is 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine.
What is the SMILES notation for 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine?
The canonical SMILES for 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine is Nc1nonc1OCC[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1.
What is the InChIKey of 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine?
The InChIKey is QQIONKJGSZDMJO-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H18N6O4/c15-13-14(17-24-16-13)23-10-9-18-5-7-19(8-6-18)11-1-3-12(4-2-11)20(21)22/h1-4H,5-10H2,(H2,15,16)/p+1.
What are the key properties of 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine?
4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine has a molecular weight of 335.34 g/mol, XLogP of -0.66, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]ethoxy]-1,2,5-oxadiazol-3-amine is sourced from PubChem (CID 7083657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).