C50H50N2 — CID 70836897
9-N,10-N-di(cyclohexa-1,5-dien-1-yl)-9-N,10-N,2,6-tetra(cyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene-9,10-diamine (PubChem CID 70836897) has the molecular formula C50H50N2 and a molecular weight of 678.96 g/mol. Its IUPAC name is 9-N,10-N-di(cyclohexa-1,5-dien-1-yl)-9-N,10-N,2,6-tetra(cyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene-9,10-diamine.
| Compound Name | 9-N,10-N-di(cyclohexa-1,5-dien-1-yl)-9-N,10-N,2,6-tetra(cyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 70836897 |
| Molecular Formula | C50H50N2 |
| Molecular Weight | 678.96 g/mol |
| Exact Mass | 678.40 |
| IUPAC Name | 9-N,10-N-di(cyclohexa-1,5-dien-1-yl)-9-N,10-N,2,6-tetra(cyclohexa-2,4-dien-1-yl)-2,3-dihydroanthracene-9,10-diamine |
| SMILES | C1=CCC(c2ccc3c(N(C4=CCCC=C4)C4C=CC=CC4)c4c(c(N(C5=CCCC=C5)C5C=CC=CC5)c3c2)=CCC(C2C=CC=CC2)C=4)C=C1 |
| InChI | InChI=1S/C50H50N2/c1-7-19-37(20-8-1)39-31-33-45-47(35-39)49(51(41-23-11-3-12-24-41)42-25-13-4-14-26-42)46-34-32-40(38-21-9-2-10-22-38)36-48(46)50(45)52(43-27-15-5-16-28-43)44-29-17-6-18-30-44/h1-3,5,7-13,15-17,19,21,23,25-27,29-31,33-38,40-41,43H,4,6,14,18,20,22,24,28,32H2 |
| InChIKey | CGFBGZJAWOJHLK-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.96 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|