C50H58N2 — CID 70836938
6-N,12-N-bis(4-tert-butylcyclohexa-1,5-dien-1-yl)-6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine (PubChem CID 70836938) has the molecular formula C50H58N2 and a molecular weight of 687.03 g/mol. Its IUPAC name is 6-N,12-N-bis(4-tert-butylcyclohexa-1,5-dien-1-yl)-6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine.
| Compound Name | 6-N,12-N-bis(4-tert-butylcyclohexa-1,5-dien-1-yl)-6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine |
|---|---|
| PubChem CID | 70836938 |
| Molecular Formula | C50H58N2 |
| Molecular Weight | 687.03 g/mol |
| Exact Mass | 686.46 |
| IUPAC Name | 6-N,12-N-bis(4-tert-butylcyclohexa-1,5-dien-1-yl)-6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine |
| SMILES | CC(C)(C)C1C=CC(N(C2=CC3=c4ccccc4=C(N(C4=CCC(C(C)(C)C)C=C4)C4C=CC=CC4)CC3C3C=CC=CC23)C2C=CC=CC2)=CC1 |
| InChI | InChI=1S/C50H58N2/c1-49(2,3)35-25-29-39(30-26-35)51(37-17-9-7-10-18-37)47-33-45-42-22-14-16-24-44(42)48(34-46(45)41-21-13-15-23-43(41)47)52(38-19-11-8-12-20-38)40-31-27-36(28-32-40)50(4,5)6/h7-17,19,21-25,27,29-33,35-38,41,43,46H,18,20,26,28,34H2,1-6H3 |
| InChIKey | CODMGKYHSGAMLT-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.03 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |