C44H46N2 — CID 70837000
6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-6-N,12-N-bis(4-methylcyclohexa-1,5-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine (PubChem CID 70837000) has the molecular formula C44H46N2 and a molecular weight of 602.87 g/mol. Its IUPAC name is 6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-6-N,12-N-bis(4-methylcyclohexa-1,5-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine.
| Compound Name | 6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-6-N,12-N-bis(4-methylcyclohexa-1,5-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine |
|---|---|
| PubChem CID | 70837000 |
| Molecular Formula | C44H46N2 |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | 6-N,12-N-di(cyclohexa-2,4-dien-1-yl)-6-N,12-N-bis(4-methylcyclohexa-1,5-dien-1-yl)-4a,4b,5,12a-tetrahydrochrysene-6,12-diamine |
| SMILES | CC1C=CC(N(C2=CC3=c4ccccc4=C(N(C4=CCC(C)C=C4)C4C=CC=CC4)CC3C3C=CC=CC23)C2C=CC=CC2)=CC1 |
| InChI | InChI=1S/C44H46N2/c1-31-21-25-35(26-22-31)45(33-13-5-3-6-14-33)43-29-41-38-18-10-12-20-40(38)44(30-42(41)37-17-9-11-19-39(37)43)46(34-15-7-4-8-16-34)36-27-23-32(2)24-28-36/h3-13,15,17-21,23,25-29,31-34,37,39,42H,14,16,22,24,30H2,1-2H3 |
| InChIKey | WCAWOPGBDHBERO-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |