C16H29F2NO — CID 70837107
2-(2,5-difluorocyclohexyl)oxy-N-[(4-methylcyclohexyl)methyl]ethanamine (PubChem CID 70837107) has the molecular formula C16H29F2NO and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(2,5-difluorocyclohexyl)oxy-N-[(4-methylcyclohexyl)methyl]ethanamine.
| Compound Name | 2-(2,5-difluorocyclohexyl)oxy-N-[(4-methylcyclohexyl)methyl]ethanamine |
|---|---|
| PubChem CID | 70837107 |
| Molecular Formula | C16H29F2NO |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-(2,5-difluorocyclohexyl)oxy-N-[(4-methylcyclohexyl)methyl]ethanamine |
| SMILES | CC1CCC(CC1)CNCCOC2CC(CCC2F)F |
| InChI | InChI=1S/C16H29F2NO/c1-12-2-4-13(5-3-12)11-19-8-9-20-16-10-14(17)6-7-15(16)18/h12-16,19H,2-11H2,1H3 |
| InChIKey | RERVEOIAGSEGFS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 269 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|