About 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene
5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene (PubChem CID 70837187) has the molecular formula C12H16F2O2
and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene |
| PubChem CID | 70837187 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene |
| SMILES | CCOCC1=CCC(OC2CC2(F)F)C=C1 |
| InChI | InChI=1S/C12H16F2O2/c1-2-15-8-9-3-5-10(6-4-9)16-11-7-12(11,13)14/h3-5,10-11H,2,6-8H2,1H3 |
| InChIKey | UESREADRTRYMGX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene?
The IUPAC name of 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene (CID 70837187) is 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene?
The canonical SMILES for 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene is CCOCC1=CCC(OC2CC2(F)F)C=C1.
What is the InChIKey of 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene?
The InChIKey is UESREADRTRYMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O2/c1-2-15-8-9-3-5-10(6-4-9)16-11-7-12(11,13)14/h3-5,10-11H,2,6-8H2,1H3.
What are the key properties of 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene?
5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene has a molecular weight of 230.25 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluorocyclopropyl)oxy-2-(ethoxymethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 70837187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).