C11H16F2O — CID 70837499
2,2-difluoro-3,7-dimethyl-3,4,4a,5,8,8a-hexahydrochromene (PubChem CID 70837499) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is 2,2-difluoro-3,7-dimethyl-3,4,4a,5,8,8a-hexahydrochromene.
| Compound Name | 2,2-difluoro-3,7-dimethyl-3,4,4a,5,8,8a-hexahydrochromene |
|---|---|
| PubChem CID | 70837499 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2,2-difluoro-3,7-dimethyl-3,4,4a,5,8,8a-hexahydrochromene |
| SMILES | CC1=CCC2CC(C)C(F)(F)OC2C1 |
| InChI | InChI=1S/C11H16F2O/c1-7-3-4-9-6-8(2)11(12,13)14-10(9)5-7/h3,8-10H,4-6H2,1-2H3 |
| InChIKey | YNGRHKUCZVMPAU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|