C15H24O — CID 70837503
5-[(1R)-2-ethylcyclopropyl]-2,6-dimethyl-2,3,3a,4,7,7a-hexahydro-1-benzofuran (PubChem CID 70837503) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-[(1R)-2-ethylcyclopropyl]-2,6-dimethyl-2,3,3a,4,7,7a-hexahydro-1-benzofuran.
| Compound Name | 5-[(1R)-2-ethylcyclopropyl]-2,6-dimethyl-2,3,3a,4,7,7a-hexahydro-1-benzofuran |
|---|---|
| PubChem CID | 70837503 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 5-[(1R)-2-ethylcyclopropyl]-2,6-dimethyl-2,3,3a,4,7,7a-hexahydro-1-benzofuran |
| SMILES | CCC1C[C@H]1C1=C(C)CC2OC(C)CC2C1 |
| InChI | InChI=1S/C15H24O/c1-4-11-7-14(11)13-8-12-6-10(3)16-15(12)5-9(13)2/h10-12,14-15H,4-8H2,1-3H3/t10?,11?,12?,14-,15?/m1/s1 |
| InChIKey | QKEIIASQBCWPQQ-WINGCZCQSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|