About (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one
(5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one (PubChem CID 70837536) has the molecular formula C12H14N2OS2
and a molecular weight of 266.39 g/mol. Its IUPAC name is (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one |
| PubChem CID | 70837536 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one |
| SMILES | C=c1[nH]c(=O)/c(=C/c2cnc(C(C)(C)C)s2)s1 |
| InChI | InChI=1S/C12H14N2OS2/c1-7-14-10(15)9(16-7)5-8-6-13-11(17-8)12(2,3)4/h5-6H,1H2,2-4H3,(H,14,15)/b9-5- |
| InChIKey | NGGXELXJGGAATF-UITAMQMPSA-N |
| XLogP | 1.43 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one?
The IUPAC name of (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one (CID 70837536) is (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one.
What is the SMILES notation for (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one?
The canonical SMILES for (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one is C=c1[nH]c(=O)/c(=C/c2cnc(C(C)(C)C)s2)s1.
What is the InChIKey of (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one?
The InChIKey is NGGXELXJGGAATF-UITAMQMPSA-N. The full InChI is InChI=1S/C12H14N2OS2/c1-7-14-10(15)9(16-7)5-8-6-13-11(17-8)12(2,3)4/h5-6H,1H2,2-4H3,(H,14,15)/b9-5-.
What are the key properties of (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one?
(5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one has a molecular weight of 266.39 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-[(2-tert-butyl-1,3-thiazol-5-yl)methylidene]-2-methylidene-1,3-thiazolidin-4-one is sourced from PubChem (CID 70837536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).