C12H17NO3S — CID 70837538
2,2,6-trimethyl-4-methylsulfonyl-3H-1,4-benzoxazine (PubChem CID 70837538) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2,2,6-trimethyl-4-methylsulfonyl-3H-1,4-benzoxazine.
| Compound Name | 2,2,6-trimethyl-4-methylsulfonyl-3H-1,4-benzoxazine |
|---|---|
| PubChem CID | 70837538 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2,2,6-trimethyl-4-methylsulfonyl-3H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)N(S(C)(=O)=O)CC(C)(C)O2 |
| InChI | InChI=1S/C12H17NO3S/c1-9-5-6-11-10(7-9)13(17(4,14)15)8-12(2,3)16-11/h5-7H,8H2,1-4H3 |
| InChIKey | VGWZUDXEMGLXSI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |