C23H26O5 — CID 70837608
5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethylphenyl]-8-methoxybicyclo[4.2.0]octa-1,3,5,7-tetraen-7-ol (PubChem CID 70837608) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethylphenyl]-8-methoxybicyclo[4.2.0]octa-1,3,5,7-tetraen-7-ol.
| Compound Name | 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethylphenyl]-8-methoxybicyclo[4.2.0]octa-1,3,5,7-tetraen-7-ol |
|---|---|
| PubChem CID | 70837608 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-2,6-dimethylphenyl]-8-methoxybicyclo[4.2.0]octa-1,3,5,7-tetraen-7-ol |
| SMILES | COC1=C(O)c2c1cccc2-c1c(C)cc(OC[C@H]2COC(C)(C)O2)cc1C |
| InChI | InChI=1S/C23H26O5/c1-13-9-15(26-11-16-12-27-23(3,4)28-16)10-14(2)19(13)17-7-6-8-18-20(17)21(24)22(18)25-5/h6-10,16,24H,11-12H2,1-5H3/t16-/m0/s1 |
| InChIKey | JCLLZKSZACAGFO-INIZCTEOSA-N |
| XLogP | 4.84 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |