About 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine
6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 70837654) has the molecular formula C11H13FO3
and a molecular weight of 212.22 g/mol. Its IUPAC name is 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine.
Molecular Properties
| Compound Name | 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
| PubChem CID | 70837654 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | COc1cc(C)c(F)c2c1OCCCO2 |
| InChI | InChI=1S/C11H13FO3/c1-7-6-8(13-2)10-11(9(7)12)15-5-3-4-14-10/h6H,3-5H2,1-2H3 |
| InChIKey | IIONEHYUQIERSN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine?
The IUPAC name of 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine (CID 70837654) is 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine?
The canonical SMILES for 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine is COc1cc(C)c(F)c2c1OCCCO2.
What is the InChIKey of 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine?
The InChIKey is IIONEHYUQIERSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO3/c1-7-6-8(13-2)10-11(9(7)12)15-5-3-4-14-10/h6H,3-5H2,1-2H3.
What are the key properties of 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine?
6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine has a molecular weight of 212.22 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-9-methoxy-7-methyl-3,4-dihydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 70837654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).