C18H26N2O4 — CID 70838359
tert-butyl 2-[(3-amino-2-oxohexanoyl)amino]-2-phenylacetate (PubChem CID 70838359) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl 2-[(3-amino-2-oxohexanoyl)amino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[(3-amino-2-oxohexanoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 70838359 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl 2-[(3-amino-2-oxohexanoyl)amino]-2-phenylacetate |
| SMILES | CCCC(N)C(=O)C(=O)NC(C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-5-9-13(19)15(21)16(22)20-14(12-10-7-6-8-11-12)17(23)24-18(2,3)4/h6-8,10-11,13-14H,5,9,19H2,1-4H3,(H,20,22) |
| InChIKey | UFHFPLHRQAVHTF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|