C22H36O2 — CID 70838927
(3S,10S,13S)-3-hydroxy-6,10,13,15,16-pentamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 70838927) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3S,10S,13S)-3-hydroxy-6,10,13,15,16-pentamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,10S,13S)-3-hydroxy-6,10,13,15,16-pentamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 70838927 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3S,10S,13S)-3-hydroxy-6,10,13,15,16-pentamethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC1CC2C(CC[C@]3(C)C(=O)C(C)C(C)C23)[C@@]2(C)CC[C@H](O)CC12 |
| InChI | InChI=1S/C22H36O2/c1-12-10-16-17(21(4)8-6-15(23)11-18(12)21)7-9-22(5)19(16)13(2)14(3)20(22)24/h12-19,23H,6-11H2,1-5H3/t12?,13?,14?,15-,16?,17?,18?,19?,21+,22-/m0/s1 |
| InChIKey | YAAAMFZJIKHRJX-ZPEVOXCKSA-N |
| XLogP | 4.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |