C18H27N3O2S — CID 70839107
N-[5-(quinolin-2-ylmethylamino)pentyl]propane-2-sulfonamide (PubChem CID 70839107) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[5-(quinolin-2-ylmethylamino)pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-(quinolin-2-ylmethylamino)pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70839107 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[5-(quinolin-2-ylmethylamino)pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNCc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H27N3O2S/c1-15(2)24(22,23)20-13-7-3-6-12-19-14-17-11-10-16-8-4-5-9-18(16)21-17/h4-5,8-11,15,19-20H,3,6-7,12-14H2,1-2H3 |
| InChIKey | QNUDMNQDQYXGJN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|