C20H32O3 — CID 70839459
3-hydroxy-6-methoxy-2,4,4,7,14-pentamethyltricyclo[5.4.3.01,8]tetradec-10-en-9-one (PubChem CID 70839459) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 3-hydroxy-6-methoxy-2,4,4,7,14-pentamethyltricyclo[5.4.3.01,8]tetradec-10-en-9-one.
| Compound Name | 3-hydroxy-6-methoxy-2,4,4,7,14-pentamethyltricyclo[5.4.3.01,8]tetradec-10-en-9-one |
|---|---|
| PubChem CID | 70839459 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 3-hydroxy-6-methoxy-2,4,4,7,14-pentamethyltricyclo[5.4.3.01,8]tetradec-10-en-9-one |
| SMILES | COC1CC(C)(C)C(O)C(C)C23C=CC(=O)C2C1(C)C(C)CC3 |
| InChI | InChI=1S/C20H32O3/c1-12-7-9-20-10-8-14(21)16(20)19(12,5)15(23-6)11-18(3,4)17(22)13(20)2/h8,10,12-13,15-17,22H,7,9,11H2,1-6H3 |
| InChIKey | YTVWLPOXJPDFQM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |