C31H37FN2O4 — CID 70839500
1-[6-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-2-(oxan-4-yl)ethanone (PubChem CID 70839500) has the molecular formula C31H37FN2O4 and a molecular weight of 520.65 g/mol. Its IUPAC name is 1-[6-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[6-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 70839500 |
| Molecular Formula | C31H37FN2O4 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 1-[6-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-2-(oxan-4-yl)ethanone |
| SMILES | CCCCOc1c(C)c(COc2ccc3c(c2)CCN(C(=O)CC2CCOCC2)C3)nc2ccc(F)cc12 |
| InChI | InChI=1S/C31H37FN2O4/c1-3-4-13-37-31-21(2)29(33-28-8-6-25(32)18-27(28)31)20-38-26-7-5-24-19-34(12-9-23(24)17-26)30(35)16-22-10-14-36-15-11-22/h5-8,17-18,22H,3-4,9-16,19-20H2,1-2H3 |
| InChIKey | JAZACRQBJZLWQC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|