C22H22IN7O — CID 70839643
N-[4-(2-iodo-4-methoxyphenyl)-6-piperidin-1-yl-1,3,5-triazin-2-yl]-1H-indazol-3-amine (PubChem CID 70839643) has the molecular formula C22H22IN7O and a molecular weight of 527.37 g/mol. Its IUPAC name is N-[4-(2-iodo-4-methoxyphenyl)-6-piperidin-1-yl-1,3,5-triazin-2-yl]-1H-indazol-3-amine.
| Compound Name | N-[4-(2-iodo-4-methoxyphenyl)-6-piperidin-1-yl-1,3,5-triazin-2-yl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 70839643 |
| Molecular Formula | C22H22IN7O |
| Molecular Weight | 527.37 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | N-[4-(2-iodo-4-methoxyphenyl)-6-piperidin-1-yl-1,3,5-triazin-2-yl]-1H-indazol-3-amine |
| SMILES | COc1ccc(-c2nc(Nc3n[nH]c4ccccc34)nc(N3CCCCC3)n2)c(I)c1 |
| InChI | InChI=1S/C22H22IN7O/c1-31-14-9-10-15(17(23)13-14)19-24-21(27-22(26-19)30-11-5-2-6-12-30)25-20-16-7-3-4-8-18(16)28-29-20/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H2,24,25,26,27,28,29) |
| InChIKey | SAXBATBWYMIEAP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|