C20H30N2O3 — CID 70839762
(4aS,8aS)-2-cyclohexyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one (PubChem CID 70839762) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (4aS,8aS)-2-cyclohexyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one.
| Compound Name | (4aS,8aS)-2-cyclohexyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
|---|---|
| PubChem CID | 70839762 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (4aS,8aS)-2-cyclohexyl-8-(morpholine-4-carbonyl)-3,4,4a,7,8,8a-hexahydroisoquinolin-1-one |
| SMILES | O=C(C1CC=C[C@@H]2CCN(C3CCCCC3)C(=O)[C@H]12)N1CCOCC1 |
| InChI | InChI=1S/C20H30N2O3/c23-19(21-11-13-25-14-12-21)17-8-4-5-15-9-10-22(20(24)18(15)17)16-6-2-1-3-7-16/h4-5,15-18H,1-3,6-14H2/t15-,17?,18+/m1/s1 |
| InChIKey | PBOAHPIFCMJENQ-IKJNGHJTSA-N |
| XLogP | 2.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|