C15H22N2O3 — CID 70839817
(4aS,8aS)-8-(4-methylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisochromen-1-one (PubChem CID 70839817) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4aS,8aS)-8-(4-methylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisochromen-1-one.
| Compound Name | (4aS,8aS)-8-(4-methylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
|---|---|
| PubChem CID | 70839817 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (4aS,8aS)-8-(4-methylpiperazine-1-carbonyl)-3,4,4a,7,8,8a-hexahydroisochromen-1-one |
| SMILES | CN1CCN(C(=O)C2CC=C[C@@H]3CCOC(=O)[C@H]23)CC1 |
| InChI | InChI=1S/C15H22N2O3/c1-16-6-8-17(9-7-16)14(18)12-4-2-3-11-5-10-20-15(19)13(11)12/h2-3,11-13H,4-10H2,1H3/t11-,12?,13+/m1/s1 |
| InChIKey | TXVIIGLMAKJWJM-YPHAAILGSA-N |
| XLogP | 0.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|