C20H18ClF2N3O3S — CID 70839867
3-[[3-(2-butoxy-4-chlorophenyl)-1,2,4-thiadiazol-5-yl]methoxy]-2,6-difluorobenzamide (PubChem CID 70839867) has the molecular formula C20H18ClF2N3O3S and a molecular weight of 453.90 g/mol. Its IUPAC name is 3-[[3-(2-butoxy-4-chlorophenyl)-1,2,4-thiadiazol-5-yl]methoxy]-2,6-difluorobenzamide.
| Compound Name | 3-[[3-(2-butoxy-4-chlorophenyl)-1,2,4-thiadiazol-5-yl]methoxy]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 70839867 |
| Molecular Formula | C20H18ClF2N3O3S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 3-[[3-(2-butoxy-4-chlorophenyl)-1,2,4-thiadiazol-5-yl]methoxy]-2,6-difluorobenzamide |
| SMILES | CCCCOc1cc(Cl)ccc1-c1nsc(COc2ccc(F)c(C(N)=O)c2F)n1 |
| InChI | InChI=1S/C20H18ClF2N3O3S/c1-2-3-8-28-15-9-11(21)4-5-12(15)20-25-16(30-26-20)10-29-14-7-6-13(22)17(18(14)23)19(24)27/h4-7,9H,2-3,8,10H2,1H3,(H2,24,27) |
| InChIKey | XENGDUWSQXAGRB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|