C26H49NO — CID 70839967
2-[[2-methyl-1-[(8Z,11E)-8-methyloctadeca-8,11-dienyl]cyclobutyl]amino]ethanol (PubChem CID 70839967) has the molecular formula C26H49NO and a molecular weight of 391.68 g/mol. Its IUPAC name is 2-[[2-methyl-1-[(8Z,11E)-8-methyloctadeca-8,11-dienyl]cyclobutyl]amino]ethanol.
| Compound Name | 2-[[2-methyl-1-[(8Z,11E)-8-methyloctadeca-8,11-dienyl]cyclobutyl]amino]ethanol |
|---|---|
| PubChem CID | 70839967 |
| Molecular Formula | C26H49NO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.38 |
| IUPAC Name | 2-[[2-methyl-1-[(8Z,11E)-8-methyloctadeca-8,11-dienyl]cyclobutyl]amino]ethanol |
| SMILES | CCCCCC/C=C/C/C=C(/C)CCCCCCCC1(NCCO)CCC1C |
| InChI | InChI=1S/C26H49NO/c1-4-5-6-7-8-9-11-14-17-24(2)18-15-12-10-13-16-20-26(27-22-23-28)21-19-25(26)3/h9,11,17,25,27-28H,4-8,10,12-16,18-23H2,1-3H3/b11-9+,24-17- |
| InChIKey | WTDKVFWRBDTJML-CYPMZRDFSA-N |
| XLogP | 7.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|