C22H24N4O — CID 70840036
N-(1-adamantylmethyl)-2-(2-cyanoethenyl)pyrazolo[1,5-a]pyridine-4-carboxamide (PubChem CID 70840036) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-(2-cyanoethenyl)pyrazolo[1,5-a]pyridine-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-2-(2-cyanoethenyl)pyrazolo[1,5-a]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 70840036 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(1-adamantylmethyl)-2-(2-cyanoethenyl)pyrazolo[1,5-a]pyridine-4-carboxamide |
| SMILES | N#CC=Cc1cc2c(C(=O)NCC34CC5CC(CC(C5)C3)C4)cccn2n1 |
| InChI | InChI=1S/C22H24N4O/c23-5-1-3-18-10-20-19(4-2-6-26(20)25-18)21(27)24-14-22-11-15-7-16(12-22)9-17(8-15)13-22/h1-4,6,10,15-17H,7-9,11-14H2,(H,24,27) |
| InChIKey | SRQINHPPJNOPEJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|