C16H24N2O2S — CID 70840874
N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(3,6-dihydro-2H-pyran-4-yl)-2-methyl-6H-1,3,5-oxathiazin-4-amine (PubChem CID 70840874) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(3,6-dihydro-2H-pyran-4-yl)-2-methyl-6H-1,3,5-oxathiazin-4-amine.
| Compound Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(3,6-dihydro-2H-pyran-4-yl)-2-methyl-6H-1,3,5-oxathiazin-4-amine |
|---|---|
| PubChem CID | 70840874 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-(3,6-dihydro-2H-pyran-4-yl)-2-methyl-6H-1,3,5-oxathiazin-4-amine |
| SMILES | CC1(C2=CCOCC2)OCN=C(N[C@H]2C[C@@H]3CC[C@H]2C3)S1 |
| InChI | InChI=1S/C16H24N2O2S/c1-16(13-4-6-19-7-5-13)20-10-17-15(21-16)18-14-9-11-2-3-12(14)8-11/h4,11-12,14H,2-3,5-10H2,1H3,(H,17,18)/t11-,12+,14+,16?/m1/s1 |
| InChIKey | AHUPQPMERZZIJY-QGMJHHGUSA-N |
| XLogP | 2.90 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|