C15H14FN3 — CID 70841013
N-[(4-fluorophenyl)methyl]-3-methyl-2H-indazol-5-amine (PubChem CID 70841013) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-methyl-2H-indazol-5-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-methyl-2H-indazol-5-amine |
|---|---|
| PubChem CID | 70841013 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-methyl-2H-indazol-5-amine |
| SMILES | Cc1[nH]nc2ccc(NCc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C15H14FN3/c1-10-14-8-13(6-7-15(14)19-18-10)17-9-11-2-4-12(16)5-3-11/h2-8,17H,9H2,1H3,(H,18,19) |
| InChIKey | YBTWEABKYYQGDG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |