About 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide
2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide (PubChem CID 70841705) has the molecular formula C22H38N2O2S
and a molecular weight of 394.63 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide |
| PubChem CID | 70841705 |
| Molecular Formula | C22H38N2O2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide |
| SMILES | CNC1CCCCC1N(C)S(=O)(=O)CCc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C22H38N2O2S/c1-16(2)18-10-9-11-19(17(3)4)20(18)14-15-27(25,26)24(6)22-13-8-7-12-21(22)23-5/h9-11,16-17,21-23H,7-8,12-15H2,1-6H3 |
| InChIKey | NZBIOXJZVCMQAU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide?
The IUPAC name of 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide (CID 70841705) is 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide.
What is the SMILES notation for 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide?
The canonical SMILES for 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide is CNC1CCCCC1N(C)S(=O)(=O)CCc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide?
The InChIKey is NZBIOXJZVCMQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38N2O2S/c1-16(2)18-10-9-11-19(17(3)4)20(18)14-15-27(25,26)24(6)22-13-8-7-12-21(22)23-5/h9-11,16-17,21-23H,7-8,12-15H2,1-6H3.
What are the key properties of 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide?
2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide has a molecular weight of 394.63 g/mol, XLogP of 4.27, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-di(propan-2-yl)phenyl]-N-methyl-N-[2-(methylamino)cyclohexyl]ethanesulfonamide is sourced from PubChem (CID 70841705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).