C14H23NO9 — CID 70841835
methyl (1S,3R,5S,8S)-2-acetyl-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate (PubChem CID 70841835) has the molecular formula C14H23NO9 and a molecular weight of 349.34 g/mol. Its IUPAC name is methyl (1S,3R,5S,8S)-2-acetyl-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | methyl (1S,3R,5S,8S)-2-acetyl-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 70841835 |
| Molecular Formula | C14H23NO9 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | methyl (1S,3R,5S,8S)-2-acetyl-8,9,10-trihydroxy-3,7-bis(hydroxymethyl)-6-oxa-2-azaspiro[4.5]decane-1-carboxylate |
| SMILES | COC(=O)[C@H]1N(C(C)=O)[C@@H](CO)C[C@]12OC(CO)[C@@H](O)C(O)C2O |
| InChI | InChI=1S/C14H23NO9/c1-6(18)15-7(4-16)3-14(11(15)13(22)23-2)12(21)10(20)9(19)8(5-17)24-14/h7-12,16-17,19-21H,3-5H2,1-2H3/t7-,8?,9-,10?,11-,12?,14+/m1/s1 |
| InChIKey | CVHLCBDHNMEJFF-IGPWWGMZSA-N |
| XLogP | -3.65 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |