C18H18F2N2O4 — CID 70842365
[2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 70842365) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 70842365 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | [2,6-difluoro-3-(2-methoxyethoxy)phenyl]-(5-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | COCCOc1ccc(F)c(C(=O)C2CNc3ncc(OC)cc32)c1F |
| InChI | InChI=1S/C18H18F2N2O4/c1-24-5-6-26-14-4-3-13(19)15(16(14)20)17(23)12-9-22-18-11(12)7-10(25-2)8-21-18/h3-4,7-8,12H,5-6,9H2,1-2H3,(H,21,22) |
| InChIKey | COXPBSAGZBFCDE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|