C21H21N8O4+ — CID 70842516
1-(7-hydroxy-4-methoxy-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 70842516) has the molecular formula C21H21N8O4+ and a molecular weight of 449.45 g/mol. Its IUPAC name is 1-(7-hydroxy-4-methoxy-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(7-hydroxy-4-methoxy-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 70842516 |
| Molecular Formula | C21H21N8O4+ |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-(7-hydroxy-4-methoxy-1H-pyrrolo[2,3-b]pyridin-7-ium-3-yl)-2-[4-(1-phenyltetrazol-5-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | COc1cc[n+](O)c2[nH]cc(C(=O)C(=O)N3CCN(c4nnnn4-c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C21H20N8O4/c1-33-16-7-8-28(32)19-17(16)15(13-22-19)18(30)20(31)26-9-11-27(12-10-26)21-23-24-25-29(21)14-5-3-2-4-6-14/h2-8,13,32H,9-12H2,1H3/p+1 |
| InChIKey | SCICZUNLPRSQRA-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|