C20H12O3S6 — CID 70842887
2,6-bis(5-thiophen-2-ylthiophen-2-yl)-1,4-dithiine 1,1,4-trioxide (PubChem CID 70842887) has the molecular formula C20H12O3S6 and a molecular weight of 492.72 g/mol. Its IUPAC name is 2,6-bis(5-thiophen-2-ylthiophen-2-yl)-1,4-dithiine 1,1,4-trioxide.
| Compound Name | 2,6-bis(5-thiophen-2-ylthiophen-2-yl)-1,4-dithiine 1,1,4-trioxide |
|---|---|
| PubChem CID | 70842887 |
| Molecular Formula | C20H12O3S6 |
| Molecular Weight | 492.72 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | 2,6-bis(5-thiophen-2-ylthiophen-2-yl)-1,4-dithiine 1,1,4-trioxide |
| SMILES | O=S1C=C(c2ccc(-c3cccs3)s2)S(=O)(=O)C(c2ccc(-c3cccs3)s2)=C1 |
| InChI | InChI=1S/C20H12O3S6/c21-28-11-19(17-7-5-15(26-17)13-3-1-9-24-13)29(22,23)20(12-28)18-8-6-16(27-18)14-4-2-10-25-14/h1-12H |
| InChIKey | HUEVOOJVBRFOFV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |