C11H15F3N2O — CID 70842977
(2R)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxane-3,5-diamine (PubChem CID 70842977) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is (2R)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxane-3,5-diamine.
| Compound Name | (2R)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxane-3,5-diamine |
|---|---|
| PubChem CID | 70842977 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (2R)-2-(2,4,5-trifluorocyclohexa-2,4-dien-1-yl)oxane-3,5-diamine |
| SMILES | NC1CO[C@H](C2CC(F)=C(F)C=C2F)C(N)C1 |
| InChI | InChI=1S/C11H15F3N2O/c12-7-3-9(14)8(13)2-6(7)11-10(16)1-5(15)4-17-11/h3,5-6,10-11H,1-2,4,15-16H2/t5?,6?,10?,11-/m1/s1 |
| InChIKey | OJYMBSVVAJDOQO-QAOWGZAFSA-N |
| XLogP | 1.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |