C22H27N2P — CID 70843063
[4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propyl]phenyl]phosphane (PubChem CID 70843063) has the molecular formula C22H27N2P and a molecular weight of 350.45 g/mol. Its IUPAC name is [4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propyl]phenyl]phosphane.
| Compound Name | [4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propyl]phenyl]phosphane |
|---|---|
| PubChem CID | 70843063 |
| Molecular Formula | C22H27N2P |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | [4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propyl]phenyl]phosphane |
| SMILES | Cc1ccc2c(c1)c1c(n2CCCc2ccc(P)cc2)CCN(C)C1 |
| InChI | InChI=1S/C22H27N2P/c1-16-5-10-21-19(14-16)20-15-23(2)13-11-22(20)24(21)12-3-4-17-6-8-18(25)9-7-17/h5-10,14H,3-4,11-13,15,25H2,1-2H3 |
| InChIKey | AWQRLRFAPXJUMM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|