C18H22N6O4 — CID 70843126
4-[2-(4-hydroxy-6-imino-1,3-dimethyl-2-oxo-1,3-diazinan-5-ylidene)hydrazinyl]-2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 70843126) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4-[2-(4-hydroxy-6-imino-1,3-dimethyl-2-oxo-1,3-diazinan-5-ylidene)hydrazinyl]-2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | 4-[2-(4-hydroxy-6-imino-1,3-dimethyl-2-oxo-1,3-diazinan-5-ylidene)hydrazinyl]-2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 70843126 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-[2-(4-hydroxy-6-imino-1,3-dimethyl-2-oxo-1,3-diazinan-5-ylidene)hydrazinyl]-2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | [H]/N=C1/C(=NNc2cccc3c2C(=O)N(CC(C)C)C3=O)C(O)N(C)C(=O)N1C |
| InChI | InChI=1S/C18H22N6O4/c1-9(2)8-24-15(25)10-6-5-7-11(12(10)16(24)26)20-21-13-14(19)22(3)18(28)23(4)17(13)27/h5-7,9,17,19-20,27H,8H2,1-4H3/b19-14-,21-13? |
| InChIKey | QKTRFVAQHZOMIB-RLSWGJSTSA-N |
| XLogP | 1.00 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|