C24H31N3O3S — CID 70844134
N-[4-[3-amino-1-(cyclopentylmethyl)-6-methoxyindol-2-yl]phenyl]propane-2-sulfonamide (PubChem CID 70844134) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[4-[3-amino-1-(cyclopentylmethyl)-6-methoxyindol-2-yl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[4-[3-amino-1-(cyclopentylmethyl)-6-methoxyindol-2-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70844134 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[4-[3-amino-1-(cyclopentylmethyl)-6-methoxyindol-2-yl]phenyl]propane-2-sulfonamide |
| SMILES | COc1ccc2c(N)c(-c3ccc(NS(=O)(=O)C(C)C)cc3)n(CC3CCCC3)c2c1 |
| InChI | InChI=1S/C24H31N3O3S/c1-16(2)31(28,29)26-19-10-8-18(9-11-19)24-23(25)21-13-12-20(30-3)14-22(21)27(24)15-17-6-4-5-7-17/h8-14,16-17,26H,4-7,15,25H2,1-3H3 |
| InChIKey | NJVAXVPPTWCXJB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |