About N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide
N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide (PubChem CID 708448) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide |
| PubChem CID | 708448 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide |
| SMILES | COc1ccc(CCNC(=S)NC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H20N2O3S/c1-22-15-9-8-13(12-16(15)23-2)10-11-19-18(24)20-17(21)14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H2,19,20,21,24) |
| InChIKey | HBOMOQRMLGFXNB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide (CID 708448) is N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide is COc1ccc(CCNC(=S)NC(=O)c2ccccc2)cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide?
The InChIKey is HBOMOQRMLGFXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-22-15-9-8-13(12-16(15)23-2)10-11-19-18(24)20-17(21)14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H2,19,20,21,24).
What are the key properties of N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide?
N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide has a molecular weight of 344.44 g/mol, XLogP of 2.55, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)ethylcarbamothioyl]benzamide is sourced from PubChem (CID 708448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).