C16H30O3 — CID 70845211
(4S,5S)-4-ethyl-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 70845211) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is (4S,5S)-4-ethyl-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-ethyl-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 70845211 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | (4S,5S)-4-ethyl-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC[C@@H]1OC(C)(C)O[C@@H]1C(/C=C\[C@@H](C)C(C)C)OC |
| InChI | InChI=1S/C16H30O3/c1-8-13-15(19-16(5,6)18-13)14(17-7)10-9-12(4)11(2)3/h9-15H,8H2,1-7H3/b10-9-/t12-,13+,14?,15+/m1/s1 |
| InChIKey | FMWODMYNKMIQBK-HYSJPGNXSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|