C22H44O4Si — CID 70845213
tert-butyl-[2-[(4S,5S)-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane (PubChem CID 70845213) has the molecular formula C22H44O4Si and a molecular weight of 400.68 g/mol. Its IUPAC name is tert-butyl-[2-[(4S,5S)-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(4S,5S)-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 70845213 |
| Molecular Formula | C22H44O4Si |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | tert-butyl-[2-[(4S,5S)-5-[(Z,4S)-1-methoxy-4,5-dimethylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
| SMILES | COC(/C=C\[C@@H](C)C(C)C)[C@H]1OC(C)(C)O[C@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si/c1-16(2)17(3)12-13-18(23-9)20-19(25-22(7,8)26-20)14-15-24-27(10,11)21(4,5)6/h12-13,16-20H,14-15H2,1-11H3/b13-12-/t17-,18?,19+,20-/m1/s1 |
| InChIKey | HAZBUEZFXWKLAW-VPDMAQQUSA-N |
| XLogP | 5.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|