C29H38N2 — CID 70845523
(3S,5S,8R,10S,13S,14S)-17-isoquinolin-5-yl-N,N,13-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-amine (PubChem CID 70845523) has the molecular formula C29H38N2 and a molecular weight of 414.64 g/mol. Its IUPAC name is (3S,5S,8R,10S,13S,14S)-17-isoquinolin-5-yl-N,N,13-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-amine.
| Compound Name | (3S,5S,8R,10S,13S,14S)-17-isoquinolin-5-yl-N,N,13-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 70845523 |
| Molecular Formula | C29H38N2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (3S,5S,8R,10S,13S,14S)-17-isoquinolin-5-yl-N,N,13-trimethyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15-tetradecahydrocyclopenta[a]phenanthren-3-amine |
| SMILES | CN(C)[C@H]1CC[C@@H]2C3CC[C@]4(C)C(c5cccc6cnccc56)=CC[C@H]4[C@@H]3CC[C@H]2C1 |
| InChI | InChI=1S/C29H38N2/c1-29-15-13-24-22-10-8-21(31(2)3)17-19(22)7-9-26(24)28(29)12-11-27(29)25-6-4-5-20-18-30-16-14-23(20)25/h4-6,11,14,16,18-19,21-22,24,26,28H,7-10,12-13,15,17H2,1-3H3/t19-,21-,22-,24?,26+,28-,29+/m0/s1 |
| InChIKey | JRZRMFWBWYQOBW-YQMBQAJYSA-N |
| XLogP | 6.81 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |