About cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium
cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium (PubChem CID 7084589) has the molecular formula C8H15F3NO+
and a molecular weight of 198.21 g/mol. Its IUPAC name is cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
Molecular Properties
| Compound Name | cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| PubChem CID | 7084589 |
| Molecular Formula | C8H15F3NO+ |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| SMILES | O[C@@H](C[NH2+]C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO/c9-8(10,11)7(13)5-12-6-3-1-2-4-6/h6-7,12-13H,1-5H2/p+1/t7-/m0/s1 |
| InChIKey | FAKWNOGFHXWHFU-ZETCQYMHSA-O |
| XLogP | 0.42 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The IUPAC name of cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium (CID 7084589) is cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
What is the SMILES notation for cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The canonical SMILES for cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium is O[C@@H](C[NH2+]C1CCCC1)C(F)(F)F.
What is the InChIKey of cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The InChIKey is FAKWNOGFHXWHFU-ZETCQYMHSA-O. The full InChI is InChI=1S/C8H14F3NO/c9-8(10,11)7(13)5-12-6-3-1-2-4-6/h6-7,12-13H,1-5H2/p+1/t7-/m0/s1.
What are the key properties of cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium has a molecular weight of 198.21 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]azanium is sourced from PubChem (CID 7084589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).