About di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium
di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium (PubChem CID 7084604) has the molecular formula C9H19F3NO+
and a molecular weight of 214.25 g/mol. Its IUPAC name is di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
Molecular Properties
| Compound Name | di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| PubChem CID | 7084604 |
| Molecular Formula | C9H19F3NO+ |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium |
| SMILES | CC(C)[NH+](C[C@@H](O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H18F3NO/c1-6(2)13(7(3)4)5-8(14)9(10,11)12/h6-8,14H,5H2,1-4H3/p+1/t8-/m1/s1 |
| InChIKey | JRYKIVPIIVAGDW-MRVPVSSYSA-O |
| XLogP | 0.61 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The IUPAC name of di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium (CID 7084604) is di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium.
What is the SMILES notation for di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The canonical SMILES for di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium is CC(C)[NH+](C[C@@H](O)C(F)(F)F)C(C)C.
What is the InChIKey of di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
The InChIKey is JRYKIVPIIVAGDW-MRVPVSSYSA-O. The full InChI is InChI=1S/C9H18F3NO/c1-6(2)13(7(3)4)5-8(14)9(10,11)12/h6-8,14H,5H2,1-4H3/p+1/t8-/m1/s1.
What are the key properties of di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium?
di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium has a molecular weight of 214.25 g/mol, XLogP of 0.61, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]azanium is sourced from PubChem (CID 7084604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).