C16H13N3O3S — CID 708461
3-[(2R)-2-naphthalen-1-yl-4-oxo-1,3-thiazolidin-3-yl]imidazolidine-2,4-dione (PubChem CID 708461) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is 3-[(2R)-2-naphthalen-1-yl-4-oxo-1,3-thiazolidin-3-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-2-naphthalen-1-yl-4-oxo-1,3-thiazolidin-3-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 708461 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-[(2R)-2-naphthalen-1-yl-4-oxo-1,3-thiazolidin-3-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1N1C(=O)CS[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C16H13N3O3S/c20-13-8-17-16(22)19(13)18-14(21)9-23-15(18)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,15H,8-9H2,(H,17,22)/t15-/m1/s1 |
| InChIKey | OZFGCVBHIMEQQB-OAHLLOKOSA-N |
| XLogP | 1.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|