About 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine
1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine (PubChem CID 70846890) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine |
| PubChem CID | 70846890 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine |
| SMILES | COCC1C[C@H](N2CCCC(C)C2C)CCN1C |
| InChI | InChI=1S/C15H30N2O/c1-12-6-5-8-17(13(12)2)14-7-9-16(3)15(10-14)11-18-4/h12-15H,5-11H2,1-4H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | SBQUCZSDPSYUCB-MIGSVPMKSA-N |
| XLogP | 2.22 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine?
The IUPAC name of 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine (CID 70846890) is 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine.
What is the SMILES notation for 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine?
The canonical SMILES for 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine is COCC1C[C@H](N2CCCC(C)C2C)CCN1C.
What is the InChIKey of 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine?
The InChIKey is SBQUCZSDPSYUCB-MIGSVPMKSA-N. The full InChI is InChI=1S/C15H30N2O/c1-12-6-5-8-17(13(12)2)14-7-9-16(3)15(10-14)11-18-4/h12-15H,5-11H2,1-4H3/t12?,13?,14-,15?/m1/s1.
What are the key properties of 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine?
1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine has a molecular weight of 254.42 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4R)-2-(methoxymethyl)-1-methylpiperidin-4-yl]-2,3-dimethylpiperidine is sourced from PubChem (CID 70846890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).